CAS 182007-75-6 appears in our catalog under these names: (S)–4–(tert–Butoxy)–2–methyl–4–oxobutanoic acid, (S)-4-(tert-Butoxy)-2-methyl-4-oxobutanoic acid, 98%, 98%, (S)-4-(tert-butoxy)-2-methyl-4-oxobutanoate, 98%, (S)-4-(tert-butoxy)-2-methyl-4-oxobutanoic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
(2S)-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 182007-75-6) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: (2S)-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: RSLMNCHJSYDERN-LURJTMIESA-N.
| Molecular formula | C9H16O4 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | (2S)-2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | RSLMNCHJSYDERN-LURJTMIESA-N |
| SMILES | C[C@@H](CC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)