CAS 76904-18-2 is the registry number for 4-(tert-Butoxy)-2-methyl-4-oxobutanoic acid. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid (CAS 76904-18-2) is a chemical compound with the molecular formula C9H16O4 and a molecular weight of 188.22 g/mol. IUPAC name: 2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid. InChIKey: RSLMNCHJSYDERN-UHFFFAOYSA-N.
| Molecular formula | C9H16O4 |
|---|---|
| Molecular weight | 188.22 g/mol |
| IUPAC name | 2-methyl-4-[(2-methylpropan-2-yl)oxy]-4-oxobutanoic acid |
| InChIKey | RSLMNCHJSYDERN-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)