Products 18201-61-1
CAS 18201-61-1 is the registry number for Benzoic acid, 2-[(2,6-dimethylphenyl)amino]-, 97%,RG. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
2-(2,6-dimethylanilino)benzoic acid (CAS 18201-61-1) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 2-(2,6-dimethylanilino)benzoic acid. InChIKey: ZKYWDEUSHBRHBI-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 2-(2,6-dimethylanilino)benzoic acid |
| InChIKey | ZKYWDEUSHBRHBI-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
2-((2,6-Dimethylphenyl)amino)benzoic acid, 2-(2,6-dimethylanilino)benzoic acid, Benzoic acid, 2-[(2,6-dimethylphenyl)amino]-, 2-(2,6-dimethylphenylamino)benzoic acid, 2-[(2,6-dimethylphenyl)amino]benzoic Acid, 2-(2,6-Dimethyl-phenylamino)-benzoic acid, ZKYWDEUSHBRHBI-UHFFFAOYSA-N, 2-((2,6-Dimethylphenyl)amino)benzoicacid