CAS 1820571-13-8 is the registry number for Rac-[(1r,5s,6r)-3-azabicyclo[3.1.0]hex-6-ylmethyl]dimethylamine dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-N,N-dimethylmethanamine;dihydrochloride (CAS 1820571-13-8) is a chemical compound with the molecular formula C8H18Cl2N2 and a molecular weight of 213.15 g/mol. IUPAC name: 1-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-N,N-dimethylmethanamine;dihydrochloride. InChIKey: VRQAWGLTFFDEEU-VOAUATQSSA-N.
| Molecular formula | C8H18Cl2N2 |
|---|---|
| Molecular weight | 213.15 g/mol |
| IUPAC name | 1-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-N,N-dimethylmethanamine;dihydrochloride |
| InChIKey | VRQAWGLTFFDEEU-VOAUATQSSA-N |
| SMILES | CN(C)CC1[C@H]2[C@@H]1CNC2.Cl.Cl |
Computed by PubChem (NCBI)