CAS 1820574-21-7 is the registry number for (3S,6S)-6-Methylmorpholine-3-carboxylic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3S,6S)-6-methylmorpholine-3-carboxylic acid;hydrochloride (CAS 1820574-21-7) is a chemical compound with the molecular formula C6H12ClNO3 and a molecular weight of 181.62 g/mol. IUPAC name: (3S,6S)-6-methylmorpholine-3-carboxylic acid;hydrochloride. InChIKey: MXADEJLMYVKMKS-FHAQVOQBSA-N.
| Molecular formula | C6H12ClNO3 |
|---|---|
| Molecular weight | 181.62 g/mol |
| IUPAC name | (3S,6S)-6-methylmorpholine-3-carboxylic acid;hydrochloride |
| InChIKey | MXADEJLMYVKMKS-FHAQVOQBSA-N |
| SMILES | C[C@H]1CN[C@@H](CO1)C(=O)O.Cl |
Computed by PubChem (NCBI)