CAS 1820575-21-0 is the registry number for [(1R,2R)-2-aminocyclohexyl]methanol hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.
[(1R,2R)-2-aminocyclohexyl]methanol;hydrochloride (CAS 1820575-21-0) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: [(1R,2R)-2-aminocyclohexyl]methanol;hydrochloride. InChIKey: ORPKUPNVXFLMRG-UOERWJHTSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | [(1R,2R)-2-aminocyclohexyl]methanol;hydrochloride |
| InChIKey | ORPKUPNVXFLMRG-UOERWJHTSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)CO)N.Cl |
Computed by PubChem (NCBI)