CAS 28250-45-5 appears in our catalog under these names: Trans-2-hydroxymethyl-1-cyclohexylamine hydrochloride, 95%, (Trans-2-aminocyclohexyl)methanol hydrochloride, 97%, rac-((1R,2R)-2-Aminocyclohexyl)methanol hydrochloride, trans-2-Hydroxymethyl-1-cyclohexylamine hydrochloride, 99+%. Offered by: Combi-blocks, AmBeed, Biosynth, Thermo Scientific (Acros). Available pack sizes: 100mg, 1g, 250mg, 5g, 50mg, 0,5g.
[(1R,2R)-2-aminocyclohexyl]methanol;hydrochloride (CAS 28250-45-5) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: [(1R,2R)-2-aminocyclohexyl]methanol;hydrochloride. InChIKey: ORPKUPNVXFLMRG-UOERWJHTSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | [(1R,2R)-2-aminocyclohexyl]methanol;hydrochloride |
| InChIKey | ORPKUPNVXFLMRG-UOERWJHTSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)CO)N.Cl |
Computed by PubChem (NCBI)