CAS 5691-37-2 appears in our catalog under these names: cis-2-Hydroxymethyl-1-cyclohexylamine hydrochloride, 99%, (cis-2-Aminocyclohexyl)methanol hydrochloride, 95%, 95%. Offered by: Thermo Scientific (Acros), Chemat. Available pack sizes: 1g.
[(1S,2R)-2-aminocyclohexyl]methanol;hydrochloride (CAS 5691-37-2) is a chemical compound with the molecular formula C7H16ClNO and a molecular weight of 165.66 g/mol. IUPAC name: [(1S,2R)-2-aminocyclohexyl]methanol;hydrochloride. InChIKey: ORPKUPNVXFLMRG-ZJLYAJKPSA-N.
| Molecular formula | C7H16ClNO |
|---|---|
| Molecular weight | 165.66 g/mol |
| IUPAC name | [(1S,2R)-2-aminocyclohexyl]methanol;hydrochloride |
| InChIKey | ORPKUPNVXFLMRG-ZJLYAJKPSA-N |
| SMILES | C1CC[C@H]([C@H](C1)CO)N.Cl |
Computed by PubChem (NCBI)