CAS 1820575-84-5 is the registry number for Trans-2-[2-(trifluoromethyl)phenyl]cyclopropan-1-amine hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
Trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride (CAS 1820575-84-5) is a chemical compound with the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. IUPAC name: trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride. InChIKey: CXCTXCXCIYKANU-DKXTVVGFSA-N.
| Molecular formula | C10H11ClF3N |
|---|---|
| Molecular weight | 237.65 g/mol |
| IUPAC name | trans-(1R,2S)-2-[2-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride |
| InChIKey | CXCTXCXCIYKANU-DKXTVVGFSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC=CC=C2C(F)(F)F.Cl |
Computed by PubChem (NCBI)