CAS 68755-41-9 appears in our catalog under these names: 6-Trifluoromethyl-indan-1-ylamine hydrochloride salt, 95%, 6–(Trifluoromethyl)–2,3–dihydro–1H–inden–1–amine hydrochloride, 6-(Trifluoromethyl)-2,3-dihydro-1H-inden-1-amine hydrochloride 95%, 2,3-Dihydro-6-(trifluoromethyl)-1H-inden-1-amine hydrochloride, 95%, 95%, 6-TRIFLUOROMETHYL-INDAN-1-YLAMINE HCL SALT, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 1g, 50mg, 5g.
6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride (CAS 68755-41-9) is a chemical compound with the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. IUPAC name: 6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride. InChIKey: SAGAPGFAJWBAEC-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3N |
|---|---|
| Molecular weight | 237.65 g/mol |
| IUPAC name | 6-(trifluoromethyl)-2,3-dihydro-1H-inden-1-amine;hydrochloride |
| InChIKey | SAGAPGFAJWBAEC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1N)C=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)