CAS 2711-55-9 appears in our catalog under these names: 2-[4-(Trifluoromethyl)phenyl]cyclopropan-1-amine hydrochloride, 95%, 2–(4–(Trifluoromethyl)phenyl)cyclopropanamine hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 100mg, 1g.
2-[4-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride (CAS 2711-55-9) is a chemical compound with the molecular formula C10H11ClF3N and a molecular weight of 237.65 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride. InChIKey: ZUMKIWBUIXZLJW-UHFFFAOYSA-N.
| Molecular formula | C10H11ClF3N |
|---|---|
| Molecular weight | 237.65 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]cyclopropan-1-amine;hydrochloride |
| InChIKey | ZUMKIWBUIXZLJW-UHFFFAOYSA-N |
| SMILES | C1C(C1N)C2=CC=C(C=C2)C(F)(F)F.Cl |
Computed by PubChem (NCBI)