CAS 1820580-43-5 is the registry number for (2R,3R)-2-(4-Chloro-3-fluorophenyl)tetrahydrofuran-3-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3R)-2-(4-chloro-3-fluorophenyl)oxolane-3-carboxylic acid (CAS 1820580-43-5) is a chemical compound with the molecular formula C11H10ClFO3 and a molecular weight of 244.64 g/mol. IUPAC name: (2R,3R)-2-(4-chloro-3-fluorophenyl)oxolane-3-carboxylic acid. InChIKey: RAZBFGMKFVRPJN-XCBNKYQSSA-N.
| Molecular formula | C11H10ClFO3 |
|---|---|
| Molecular weight | 244.64 g/mol |
| IUPAC name | (2R,3R)-2-(4-chloro-3-fluorophenyl)oxolane-3-carboxylic acid |
| InChIKey | RAZBFGMKFVRPJN-XCBNKYQSSA-N |
| SMILES | C1CO[C@H]([C@@H]1C(=O)O)C2=CC(=C(C=C2)Cl)F |
Computed by PubChem (NCBI)