CAS 72835-76-8 is the registry number for Ethyl 3-(3-chloro-4-fluorophenyl)-3-oxopropanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.
Ethyl 3-(3-chloro-4-fluorophenyl)-3-oxopropanoate (CAS 72835-76-8) is a chemical compound with the molecular formula C11H10ClFO3 and a molecular weight of 244.64 g/mol. IUPAC name: ethyl 3-(3-chloro-4-fluorophenyl)-3-oxopropanoate. InChIKey: KUOACPMHJWOZNC-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFO3 |
|---|---|
| Molecular weight | 244.64 g/mol |
| IUPAC name | ethyl 3-(3-chloro-4-fluorophenyl)-3-oxopropanoate |
| InChIKey | KUOACPMHJWOZNC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=CC(=C(C=C1)F)Cl |
Computed by PubChem (NCBI)