Products 72835-76-8

CAS 72835-76-8 is the registry number for Ethyl 3-(3-chloro-4-fluorophenyl)-3-oxopropanoate. Offered by: Biosynth. Available pack sizes: 2,5g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 3-(3-chloro-4-fluorophenyl)-3-oxopropanoate (CAS 72835-76-8) is a chemical compound with the molecular formula C11H10ClFO3 and a molecular weight of 244.64 g/mol. IUPAC name: ethyl 3-(3-chloro-4-fluorophenyl)-3-oxopropanoate. InChIKey: KUOACPMHJWOZNC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClFO3
Molecular weight244.64 g/mol
IUPAC nameethyl 3-(3-chloro-4-fluorophenyl)-3-oxopropanoate
InChIKeyKUOACPMHJWOZNC-UHFFFAOYSA-N
SMILESCCOC(=O)CC(=O)C1=CC(=C(C=C1)F)Cl

Computed by PubChem (NCBI)