CAS 951784-87-5 is the registry number for Ethyl 3-(2-chloro-5-fluorophenyl)-3-oxopropanoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Ethyl 3-(2-chloro-5-fluorophenyl)-3-oxopropanoate (CAS 951784-87-5) is a chemical compound with the molecular formula C11H10ClFO3 and a molecular weight of 244.64 g/mol. IUPAC name: ethyl 3-(2-chloro-5-fluorophenyl)-3-oxopropanoate. InChIKey: WUCDLJMUHXSUOG-UHFFFAOYSA-N.
| Molecular formula | C11H10ClFO3 |
|---|---|
| Molecular weight | 244.64 g/mol |
| IUPAC name | ethyl 3-(2-chloro-5-fluorophenyl)-3-oxopropanoate |
| InChIKey | WUCDLJMUHXSUOG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)C1=C(C=CC(=C1)F)Cl |
Computed by PubChem (NCBI)