CAS 1820583-70-7 is the registry number for Rac-(3ar,5r,6s,7as)-octahydro-1h-isoindole-5,6-diol hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(3aR,5R,6S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-5,6-diol;hydrochloride (CAS 1820583-70-7) is a chemical compound with the molecular formula C8H16ClNO2 and a molecular weight of 193.67 g/mol. IUPAC name: (3aR,5R,6S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-5,6-diol;hydrochloride. InChIKey: NINXDDYEJBPMCT-WTSYXZODSA-N.
| Molecular formula | C8H16ClNO2 |
|---|---|
| Molecular weight | 193.67 g/mol |
| IUPAC name | (3aR,5R,6S,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-isoindole-5,6-diol;hydrochloride |
| InChIKey | NINXDDYEJBPMCT-WTSYXZODSA-N |
| SMILES | C1[C@@H]2CNC[C@@H]2C[C@H]([C@H]1O)O.Cl |
Computed by PubChem (NCBI)