CAS 1820585-09-8 is the registry number for 5-Methoxy-6-nitroisoindoline, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-methoxy-6-nitro-2,3-dihydro-1H-isoindole (CAS 1820585-09-8) is a chemical compound with the molecular formula C9H10N2O3 and a molecular weight of 194.19 g/mol. IUPAC name: 5-methoxy-6-nitro-2,3-dihydro-1H-isoindole. InChIKey: VWMFFLFDDVUFIN-UHFFFAOYSA-N.
| Molecular formula | C9H10N2O3 |
|---|---|
| Molecular weight | 194.19 g/mol |
| IUPAC name | 5-methoxy-6-nitro-2,3-dihydro-1H-isoindole |
| InChIKey | VWMFFLFDDVUFIN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2CNCC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)