Products 1820684-94-3
CAS 1820684-94-3 is the registry number for 2-amino-6-chloro-1,3-benzoxazole-5-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-6-chloro-1,3-benzoxazole-5-carboxylic acid (CAS 1820684-94-3) is a chemical compound with the molecular formula C8H5ClN2O3 and a molecular weight of 212.59 g/mol. IUPAC name: 2-amino-6-chloro-1,3-benzoxazole-5-carboxylic acid. InChIKey: ADVIVDKAGSKIER-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O3 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | 2-amino-6-chloro-1,3-benzoxazole-5-carboxylic acid |
| InChIKey | ADVIVDKAGSKIER-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1N=C(O2)N)Cl)C(=O)O |
Computed by PubChem (NCBI)