CAS 221638-74-0 appears in our catalog under these names: 2-(Chloromethyl)-6-nitro-1,3-benzoxazole, 95%, 2-(Chloromethyl)-6-nitrobenzo(d)oxazole, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(chloromethyl)-6-nitro-1,3-benzoxazole (CAS 221638-74-0) is a chemical compound with the molecular formula C8H5ClN2O3 and a molecular weight of 212.59 g/mol. IUPAC name: 2-(chloromethyl)-6-nitro-1,3-benzoxazole. InChIKey: LPTHKRDEKSFWAO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O3 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | 2-(chloromethyl)-6-nitro-1,3-benzoxazole |
| InChIKey | LPTHKRDEKSFWAO-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1[N+](=O)[O-])OC(=N2)CCl |
Computed by PubChem (NCBI)