CAS 77859-57-5 appears in our catalog under these names: 6-Chloro-5-nitro-1,3-dihydro-2h-indol-2-one, 95%, 6-Chloro-5-nitroindolin-2-one, 97%, 97%. Offered by: Combi-blocks, Chemat. Available pack sizes: 250mg, 1g, 100mg, 500mg.
6-chloro-5-nitro-1,3-dihydroindol-2-one (CAS 77859-57-5) is a chemical compound with the molecular formula C8H5ClN2O3 and a molecular weight of 212.59 g/mol. IUPAC name: 6-chloro-5-nitro-1,3-dihydroindol-2-one. InChIKey: KKHHDJYQGADKEQ-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O3 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | 6-chloro-5-nitro-1,3-dihydroindol-2-one |
| InChIKey | KKHHDJYQGADKEQ-UHFFFAOYSA-N |
| SMILES | C1C2=CC(=C(C=C2NC1=O)Cl)[N+](=O)[O-] |
Computed by PubChem (NCBI)