CAS 1301214-58-3 appears in our catalog under these names: 7-Chloro-2-oxo-2,3-dihydro-1H-benzo(d)imidazole-5-carboxylic acid, 98%, 7-Chloro-2-oxo-2,3-dihydro-1H-1,3-benzodiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid (CAS 1301214-58-3) is a chemical compound with the molecular formula C8H5ClN2O3 and a molecular weight of 212.59 g/mol. IUPAC name: 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid. InChIKey: LQFOELDGFDCQMH-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2O3 |
|---|---|
| Molecular weight | 212.59 g/mol |
| IUPAC name | 7-chloro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid |
| InChIKey | LQFOELDGFDCQMH-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1NC(=O)N2)Cl)C(=O)O |
Computed by PubChem (NCBI)