Products 1820686-50-7
CAS 1820686-50-7 is the registry number for 3-Bromo-5-nitro-4-(propylamino)benzonitrile, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
3-bromo-5-nitro-4-(propylamino)benzonitrile (CAS 1820686-50-7) is a chemical compound with the molecular formula C10H10BrN3O2 and a molecular weight of 284.11 g/mol. IUPAC name: 3-bromo-5-nitro-4-(propylamino)benzonitrile. InChIKey: WXQUNOVYGOXVIR-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3O2 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 3-bromo-5-nitro-4-(propylamino)benzonitrile |
| InChIKey | WXQUNOVYGOXVIR-UHFFFAOYSA-N |
| SMILES | CCCNC1=C(C=C(C=C1Br)C#N)[N+](=O)[O-] |
Computed by PubChem (NCBI)