CAS 1820666-73-6 is the registry number for 7-Bromo-1-propyl-1,2,3-benzotriazole-5-carboxylic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
7-bromo-1-propylbenzotriazole-5-carboxylic acid (CAS 1820666-73-6) is a chemical compound with the molecular formula C10H10BrN3O2 and a molecular weight of 284.11 g/mol. IUPAC name: 7-bromo-1-propylbenzotriazole-5-carboxylic acid. InChIKey: IMCDTFDNOQSTDB-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3O2 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 7-bromo-1-propylbenzotriazole-5-carboxylic acid |
| InChIKey | IMCDTFDNOQSTDB-UHFFFAOYSA-N |
| SMILES | CCCN1C2=C(C=C(C=C2Br)C(=O)O)N=N1 |
Computed by PubChem (NCBI)