Products 1209061-41-5
CAS 1209061-41-5 is the registry number for N-(2-(1H-Imidazol-1-yl)ethyl)-5-bromofuran-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
5-bromo-N-(2-imidazol-1-ylethyl)furan-2-carboxamide (CAS 1209061-41-5) is a chemical compound with the molecular formula C10H10BrN3O2 and a molecular weight of 284.11 g/mol. IUPAC name: 5-bromo-N-(2-imidazol-1-ylethyl)furan-2-carboxamide. InChIKey: QOLPQUZUXGULID-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3O2 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | 5-bromo-N-(2-imidazol-1-ylethyl)furan-2-carboxamide |
| InChIKey | QOLPQUZUXGULID-UHFFFAOYSA-N |
| SMILES | C1=CN(C=N1)CCNC(=O)C2=CC=C(O2)Br |
Computed by PubChem (NCBI)