CAS 1423037-30-2 is the registry number for Ethyl 7-bromo-1-methyl-1,2,3-benzotriazole-5-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 1g, 5g.
Ethyl 7-bromo-1-methylbenzotriazole-5-carboxylate (CAS 1423037-30-2) is a chemical compound with the molecular formula C10H10BrN3O2 and a molecular weight of 284.11 g/mol. IUPAC name: ethyl 7-bromo-1-methylbenzotriazole-5-carboxylate. InChIKey: UYDCEZGEAUFQOH-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN3O2 |
|---|---|
| Molecular weight | 284.11 g/mol |
| IUPAC name | ethyl 7-bromo-1-methylbenzotriazole-5-carboxylate |
| InChIKey | UYDCEZGEAUFQOH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C(=C1)Br)N(N=N2)C |
Computed by PubChem (NCBI)