Products 1820687-28-2

CAS 1820687-28-2 is the registry number for methyl 2-{2-oxo-9-oxatricyclo[9.4.0.0^{3,8}]pentadeca-1(11),3,5,7,12,14-hexaen-14-yl}acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

Methyl 2-(11-oxo-6H-benzo[c][1]benzoxepin-9-yl)acetate (CAS 1820687-28-2) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: methyl 2-(11-oxo-6H-benzo[c][1]benzoxepin-9-yl)acetate. InChIKey: ORGDNZWXZYXLJX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H14O4
Molecular weight282.29 g/mol
IUPAC namemethyl 2-(11-oxo-6H-benzo[c][1]benzoxepin-9-yl)acetate
InChIKeyORGDNZWXZYXLJX-UHFFFAOYSA-N
SMILESCOC(=O)CC1=CC2=C(COC3=CC=CC=C3C2=O)C=C1

Computed by PubChem (NCBI)