CAS 20979-50-4 appears in our catalog under these names: 7-Methoxy-2-(4-methoxyphenyl)-4H-chromen-4-one, 97%, 7,4'-Dimethoxyflavone, 95%, 7,4'-Dimethoxyflavone. Offered by: AmBeed, Combi-blocks, Biosynth. Available pack sizes: 25g, 1g, 10g, 5g, 2g.
7-methoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 20979-50-4) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 7-methoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: LGTXUFBDCDFQIU-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 7-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | LGTXUFBDCDFQIU-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=C(C=C3)OC |
Computed by PubChem (NCBI)