Products 6697-63-8
CAS 6697-63-8 appears in our catalog under these names: 5,4'-Dimethoxyflavone, 95%, 5,4'-Dimethoxyflavone, 5,4'-Dimethoxyflavone, min. 95 %, 50 mg, 5,4'-Dimethoxyflavone, min. 95 %, 100 mg, 5,4'-Dimethoxyflavone, min. 95 %, 250 mg. Offered by: Combi-blocks, Biosynth, Roth. Available pack sizes: 100mg, 250mg, 500mg, 1000mg, 50mg, 1g.
5-methoxy-2-(4-methoxyphenyl)chromen-4-one (CAS 6697-63-8) is a chemical compound with the molecular formula C17H14O4 and a molecular weight of 282.29 g/mol. IUPAC name: 5-methoxy-2-(4-methoxyphenyl)chromen-4-one. InChIKey: LUCPCQIWHDVLMX-UHFFFAOYSA-N.
| Molecular formula | C17H14O4 |
|---|---|
| Molecular weight | 282.29 g/mol |
| IUPAC name | 5-methoxy-2-(4-methoxyphenyl)chromen-4-one |
| InChIKey | LUCPCQIWHDVLMX-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=CC(=O)C3=C(O2)C=CC=C3OC |
Computed by PubChem (NCBI)