CAS 1820712-14-8 is the registry number for N,N-Bis(4-cyanophenethyl)methanesulfonamide, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
N,N-bis[2-(4-cyanophenyl)ethyl]methanesulfonamide (CAS 1820712-14-8) is a chemical compound with the molecular formula C19H19N3O2S and a molecular weight of 353.4 g/mol. IUPAC name: N,N-bis[2-(4-cyanophenyl)ethyl]methanesulfonamide. InChIKey: HZSKLGXGFJFYMB-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O2S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | N,N-bis[2-(4-cyanophenyl)ethyl]methanesulfonamide |
| InChIKey | HZSKLGXGFJFYMB-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N(CCC1=CC=C(C=C1)C#N)CCC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)