Products 903195-59-5
CAS 903195-59-5 is the registry number for 3-(4-phenylpiperazinyl)-2-(phenylsulfonyl)prop-2-enenitrile. Offered by: Biosynth. Available pack sizes: 250mg.
(E)-2-(benzenesulfonyl)-3-(4-phenylpiperazin-1-yl)prop-2-enenitrile (CAS 903195-59-5) is a chemical compound with the molecular formula C19H19N3O2S and a molecular weight of 353.4 g/mol. IUPAC name: (E)-2-(benzenesulfonyl)-3-(4-phenylpiperazin-1-yl)prop-2-enenitrile. InChIKey: ZWAMPEYHWOAXKW-KNTRCKAVSA-N.
| Molecular formula | C19H19N3O2S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (E)-2-(benzenesulfonyl)-3-(4-phenylpiperazin-1-yl)prop-2-enenitrile |
| InChIKey | ZWAMPEYHWOAXKW-KNTRCKAVSA-N |
| SMILES | C1CN(CCN1/C=C(\C#N)/S(=O)(=O)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)