CAS 717917-14-1 is the registry number for Conivaptan Impurity 6. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
2-methyl-6-(4-methylphenyl)sulfonyl-4,5-dihydro-3H-imidazo[4,5-d][1]benzazepine (CAS 717917-14-1) is a chemical compound with the molecular formula C19H19N3O2S and a molecular weight of 353.4 g/mol. IUPAC name: 2-methyl-6-(4-methylphenyl)sulfonyl-4,5-dihydro-3H-imidazo[4,5-d][1]benzazepine. InChIKey: FJMULJYPXDDJSY-UHFFFAOYSA-N.
| Molecular formula | C19H19N3O2S |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 2-methyl-6-(4-methylphenyl)sulfonyl-4,5-dihydro-3H-imidazo[4,5-d][1]benzazepine |
| InChIKey | FJMULJYPXDDJSY-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CCC3=C(C4=CC=CC=C42)N=C(N3)C |
Computed by PubChem (NCBI)