CAS 1820717-39-2 appears in our catalog under these names: 5-Chloro-7-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride, 95%, 5-Chloro-7-fluoro-1,2,3,4-tetrahydroisoquinoline hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
5-chloro-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride (CAS 1820717-39-2) is a chemical compound with the molecular formula C9H10Cl2FN and a molecular weight of 222.08 g/mol. IUPAC name: 5-chloro-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride. InChIKey: VYGIOWNRCSWSKE-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2FN |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | 5-chloro-7-fluoro-1,2,3,4-tetrahydroisoquinoline;hydrochloride |
| InChIKey | VYGIOWNRCSWSKE-UHFFFAOYSA-N |
| SMILES | C1CNCC2=C1C(=CC(=C2)F)Cl.Cl |
Computed by PubChem (NCBI)