Products 2514691-70-2
CAS 2514691-70-2 is the registry number for rac-(1R,2S)-2-(3-Chloro-4-fluorophenyl)cyclopropan-1-amine Monohydrochloride. Offered by: TRC. Available pack sizes: 1g.
Trans-(1R,2S)-2-(3-chloro-4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 2514691-70-2) is a chemical compound with the molecular formula C9H10Cl2FN and a molecular weight of 222.08 g/mol. IUPAC name: trans-(1R,2S)-2-(3-chloro-4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: PIQWGZUFAOCFST-RDNZEXAOSA-N.
| Molecular formula | C9H10Cl2FN |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3-chloro-4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | PIQWGZUFAOCFST-RDNZEXAOSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=C(C=C2)F)Cl.Cl |
Computed by PubChem (NCBI)