Products 2095320-57-1
CAS 2095320-57-1 is the registry number for 1-(3-Chloro-4-fluorophenyl)cyclopropan-1-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(3-chloro-4-fluorophenyl)cyclopropan-1-amine;hydrochloride (CAS 2095320-57-1) is a chemical compound with the molecular formula C9H10Cl2FN and a molecular weight of 222.08 g/mol. IUPAC name: 1-(3-chloro-4-fluorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: REPIOQYDOPVQDI-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2FN |
|---|---|
| Molecular weight | 222.08 g/mol |
| IUPAC name | 1-(3-chloro-4-fluorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | REPIOQYDOPVQDI-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC(=C(C=C2)F)Cl)N.Cl |
Computed by PubChem (NCBI)