Products 1820735-45-2
CAS 1820735-45-2 is the registry number for 6-chloro-5-methyl-7-nitro-1,3-benzoxazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
6-chloro-5-methyl-7-nitro-1,3-benzoxazol-2-amine (CAS 1820735-45-2) is a chemical compound with the molecular formula C8H6ClN3O3 and a molecular weight of 227.60 g/mol. IUPAC name: 6-chloro-5-methyl-7-nitro-1,3-benzoxazol-2-amine. InChIKey: OJIYUCZCRWOPSJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O3 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 6-chloro-5-methyl-7-nitro-1,3-benzoxazol-2-amine |
| InChIKey | OJIYUCZCRWOPSJ-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=C1Cl)[N+](=O)[O-])OC(=N2)N |
Computed by PubChem (NCBI)