Products 1934595-97-7
CAS 1934595-97-7 is the registry number for 3-(4-Chloro-1-methyl-1H-pyrazol-5-yl)-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(4-chloro-1-methylpyrazol-5-yl)-1,2-oxazole-5-carboxylic acid (CAS 1934595-97-7) is a chemical compound with the molecular formula C8H6ClN3O3 and a molecular weight of 227.60 g/mol. IUPAC name: 3-(4-chloro-1-methylpyrazol-5-yl)-1,2-oxazole-5-carboxylic acid. InChIKey: ULZIQSUGGYNURA-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O3 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 3-(4-chloro-1-methylpyrazol-5-yl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | ULZIQSUGGYNURA-UHFFFAOYSA-N |
| SMILES | CN1C(=C(C=N1)Cl)C2=NOC(=C2)C(=O)O |
Computed by PubChem (NCBI)