CAS 869947-01-3 is the registry number for 7-Chloromethyl-5-oxo-4,5-dihydro-pyrazolo(1,5- a )pyrimidine-2-carboxylic acid. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
7-(chloromethyl)-5-oxo-4H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 869947-01-3) is a chemical compound with the molecular formula C8H6ClN3O3 and a molecular weight of 227.60 g/mol. IUPAC name: 7-(chloromethyl)-5-oxo-4H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: WJXYANQIRGFTJR-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O3 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 7-(chloromethyl)-5-oxo-4H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | WJXYANQIRGFTJR-UHFFFAOYSA-N |
| SMILES | C1=C(N2C(=CC(=N2)C(=O)O)NC1=O)CCl |
Computed by PubChem (NCBI)