CAS 2279124-22-8 is the registry number for 5-(Chloromethyl)-7-oxo-6,7-dihydropyrazolo[1,5-a]pyrimidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 500mg.
5-(chloromethyl)-7-oxo-6H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid (CAS 2279124-22-8) is a chemical compound with the molecular formula C8H6ClN3O3 and a molecular weight of 227.60 g/mol. IUPAC name: 5-(chloromethyl)-7-oxo-6H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid. InChIKey: ZHFRUUVRNUCSHJ-UHFFFAOYSA-N.
| Molecular formula | C8H6ClN3O3 |
|---|---|
| Molecular weight | 227.60 g/mol |
| IUPAC name | 5-(chloromethyl)-7-oxo-6H-pyrazolo[1,5-a]pyrimidine-2-carboxylic acid |
| InChIKey | ZHFRUUVRNUCSHJ-UHFFFAOYSA-N |
| SMILES | C1C(=NC2=CC(=NN2C1=O)C(=O)O)CCl |
Computed by PubChem (NCBI)