Products 1820741-46-5

CAS 1820741-46-5 is the registry number for 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-amino-5-fluoro-1,3-benzoxazole-6-carboxylic acid (CAS 1820741-46-5) is a chemical compound with the molecular formula C8H5FN2O3 and a molecular weight of 196.13 g/mol. IUPAC name: 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylic acid. InChIKey: RZGARKJZFUYABL-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5FN2O3
Molecular weight196.13 g/mol
IUPAC name2-amino-5-fluoro-1,3-benzoxazole-6-carboxylic acid
InChIKeyRZGARKJZFUYABL-UHFFFAOYSA-N
SMILESC1=C(C(=CC2=C1OC(=N2)N)F)C(=O)O

Computed by PubChem (NCBI)