CAS 1820741-46-5 is the registry number for 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-amino-5-fluoro-1,3-benzoxazole-6-carboxylic acid (CAS 1820741-46-5) is a chemical compound with the molecular formula C8H5FN2O3 and a molecular weight of 196.13 g/mol. IUPAC name: 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylic acid. InChIKey: RZGARKJZFUYABL-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O3 |
|---|---|
| Molecular weight | 196.13 g/mol |
| IUPAC name | 2-amino-5-fluoro-1,3-benzoxazole-6-carboxylic acid |
| InChIKey | RZGARKJZFUYABL-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC2=C1OC(=N2)N)F)C(=O)O |
Computed by PubChem (NCBI)