CAS 1266336-47-3 is the registry number for 7-Fluoro-5-nitroindolin-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
7-fluoro-5-nitro-1,3-dihydroindol-2-one (CAS 1266336-47-3) is a chemical compound with the molecular formula C8H5FN2O3 and a molecular weight of 196.13 g/mol. IUPAC name: 7-fluoro-5-nitro-1,3-dihydroindol-2-one. InChIKey: XXFNBOCVFGQROZ-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O3 |
|---|---|
| Molecular weight | 196.13 g/mol |
| IUPAC name | 7-fluoro-5-nitro-1,3-dihydroindol-2-one |
| InChIKey | XXFNBOCVFGQROZ-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)[N+](=O)[O-])F)NC1=O |
Computed by PubChem (NCBI)