CAS 40703-40-0 appears in our catalog under these names: 5-Fluoro-2-methyl-6-nitro-1,3-benzoxazole 95%, 5-Fluoro-2-methyl-6-nitro-1,3-benzoxazole, 97%, 97%, 5-Fluoro-2-methyl-6-nitrobenzo[d]oxazole, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg.
5-fluoro-2-methyl-6-nitro-1,3-benzoxazole (CAS 40703-40-0) is a chemical compound with the molecular formula C8H5FN2O3 and a molecular weight of 196.13 g/mol. IUPAC name: 5-fluoro-2-methyl-6-nitro-1,3-benzoxazole. InChIKey: PXORJXRXQSDPHW-UHFFFAOYSA-N.
| Molecular formula | C8H5FN2O3 |
|---|---|
| Molecular weight | 196.13 g/mol |
| IUPAC name | 5-fluoro-2-methyl-6-nitro-1,3-benzoxazole |
| InChIKey | PXORJXRXQSDPHW-UHFFFAOYSA-N |
| SMILES | CC1=NC2=CC(=C(C=C2O1)[N+](=O)[O-])F |
Computed by PubChem (NCBI)