Products 1388060-01-2

CAS 1388060-01-2 is the registry number for 6-Fluoro-2-oxo-2,3-dihydro-1H-benzo[d]imidazole-5-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

6-fluoro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid (CAS 1388060-01-2) is a chemical compound with the molecular formula C8H5FN2O3 and a molecular weight of 196.13 g/mol. IUPAC name: 6-fluoro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid. InChIKey: NSJVPMRXKYFRLE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5FN2O3
Molecular weight196.13 g/mol
IUPAC name6-fluoro-2-oxo-1,3-dihydrobenzimidazole-5-carboxylic acid
InChIKeyNSJVPMRXKYFRLE-UHFFFAOYSA-N
SMILESC1=C(C(=CC2=C1NC(=O)N2)F)C(=O)O

Computed by PubChem (NCBI)