Products 1821658-38-1

CAS 1821658-38-1 is the registry number for Viladozone Acetyl Chloride. Offered by: TRC. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

4-(5-cyano-1H-indol-3-yl)butanoyl chloride (CAS 1821658-38-1) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: 4-(5-cyano-1H-indol-3-yl)butanoyl chloride. InChIKey: XTAAVTZYSKGKOH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11ClN2O
Molecular weight246.69 g/mol
IUPAC name4-(5-cyano-1H-indol-3-yl)butanoyl chloride
InChIKeyXTAAVTZYSKGKOH-UHFFFAOYSA-N
SMILESC1=CC2=C(C=C1C#N)C(=CN2)CCCC(=O)Cl

Computed by PubChem (NCBI)