CAS 1821658-38-1 is the registry number for Viladozone Acetyl Chloride. Offered by: TRC. Available pack sizes: 250mg.
4-(5-cyano-1H-indol-3-yl)butanoyl chloride (CAS 1821658-38-1) is a chemical compound with the molecular formula C13H11ClN2O and a molecular weight of 246.69 g/mol. IUPAC name: 4-(5-cyano-1H-indol-3-yl)butanoyl chloride. InChIKey: XTAAVTZYSKGKOH-UHFFFAOYSA-N.
| Molecular formula | C13H11ClN2O |
|---|---|
| Molecular weight | 246.69 g/mol |
| IUPAC name | 4-(5-cyano-1H-indol-3-yl)butanoyl chloride |
| InChIKey | XTAAVTZYSKGKOH-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C#N)C(=CN2)CCCC(=O)Cl |
Computed by PubChem (NCBI)