CAS 1821770-21-1 is the registry number for Methyl (3R,4R)-1-benzyl-4-methylpyrrolidine-3-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g, 25g.
Methyl (3R,4R)-1-benzyl-4-methylpyrrolidine-3-carboxylate (CAS 1821770-21-1) is a chemical compound with the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. IUPAC name: methyl (3R,4R)-1-benzyl-4-methylpyrrolidine-3-carboxylate. InChIKey: KLQYKJMMAPSQCP-AAEUAGOBSA-N.
| Molecular formula | C14H19NO2 |
|---|---|
| Molecular weight | 233.31 g/mol |
| IUPAC name | methyl (3R,4R)-1-benzyl-4-methylpyrrolidine-3-carboxylate |
| InChIKey | KLQYKJMMAPSQCP-AAEUAGOBSA-N |
| SMILES | C[C@H]1CN(C[C@@H]1C(=O)OC)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)