CAS 1821795-52-1 is the registry number for Methyl (R)-1,2,3,4-tetrahydroquinoline-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (4R)-1,2,3,4-tetrahydroquinoline-4-carboxylate (CAS 1821795-52-1) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: methyl (4R)-1,2,3,4-tetrahydroquinoline-4-carboxylate. InChIKey: LHPKFPPTKHGWCC-SECBINFHSA-N.
| Molecular formula | C11H13NO2 |
|---|---|
| Molecular weight | 191.23 g/mol |
| IUPAC name | methyl (4R)-1,2,3,4-tetrahydroquinoline-4-carboxylate |
| InChIKey | LHPKFPPTKHGWCC-SECBINFHSA-N |
| SMILES | COC(=O)[C@@H]1CCNC2=CC=CC=C12 |
Computed by PubChem (NCBI)