Products 68066-85-3

CAS 68066-85-3 is the registry number for Methyl 1,2,3,4-tetrahydroquinoline-4-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 1,2,3,4-tetrahydroquinoline-4-carboxylate (CAS 68066-85-3) is a chemical compound with the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. IUPAC name: methyl 1,2,3,4-tetrahydroquinoline-4-carboxylate. InChIKey: LHPKFPPTKHGWCC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13NO2
Molecular weight191.23 g/mol
IUPAC namemethyl 1,2,3,4-tetrahydroquinoline-4-carboxylate
InChIKeyLHPKFPPTKHGWCC-UHFFFAOYSA-N
SMILESCOC(=O)C1CCNC2=CC=CC=C12

Computed by PubChem (NCBI)