CAS 959417-67-5 appears in our catalog under these names: Di-tert-butyl 2-methylpiperazine-1,4-dicarboxylate, 97%, 1,4–Di–tert–butyl 2–methylpiperazine–1,4–dicarboxylate, 1,4-Di-tert-butyl 2-methylpiperazine-1,4-dicarboxylate, 1,4-Di-tert-butyl 2-methylpiperazine-1,4-dicarboxylate, 1,4-Di-tert-butyl 2-methylpiperazine-1,4, -dicarboxylate, 50 mg. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 100mg, 1g, 250mg, 5g, 50mg, 1000mg, 500mg.
Ditert-butyl 2-methylpiperazine-1,4-dicarboxylate (CAS 959417-67-5) is a chemical compound with the molecular formula C15H28N2O4 and a molecular weight of 300.39 g/mol. IUPAC name: ditert-butyl 2-methylpiperazine-1,4-dicarboxylate. InChIKey: IMKNVNIIMKCRIO-UHFFFAOYSA-N.
| Molecular formula | C15H28N2O4 |
|---|---|
| Molecular weight | 300.39 g/mol |
| IUPAC name | ditert-butyl 2-methylpiperazine-1,4-dicarboxylate |
| InChIKey | IMKNVNIIMKCRIO-UHFFFAOYSA-N |
| SMILES | CC1CN(CCN1C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)