CAS 1821811-20-4 is the registry number for (S)-tert-Butyl 2-carbamoylmorpholine-4-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g.
Tert-butyl (2S)-2-carbamoylmorpholine-4-carboxylate (CAS 1821811-20-4) is a chemical compound with the molecular formula C10H18N2O4 and a molecular weight of 230.26 g/mol. IUPAC name: tert-butyl (2S)-2-carbamoylmorpholine-4-carboxylate. InChIKey: ZSWWTDBVKVWIAD-ZETCQYMHSA-N.
| Molecular formula | C10H18N2O4 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | tert-butyl (2S)-2-carbamoylmorpholine-4-carboxylate |
| InChIKey | ZSWWTDBVKVWIAD-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCO[C@@H](C1)C(=O)N |
Computed by PubChem (NCBI)