Products 1821908-49-9
CAS 1821908-49-9 appears in our catalog under these names: SGC2085 HCl, SGC2085 (hydrochloride), SGC2085 Hydrochloride, SGC2085 (hydrochloride). Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM 1ml in dmso.
(2S)-2-amino-N-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]propanamide;hydrochloride (CAS 1821908-49-9) is a chemical compound with the molecular formula C19H25ClN2O2 and a molecular weight of 348.9 g/mol. IUPAC name: (2S)-2-amino-N-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]propanamide;hydrochloride. InChIKey: OQGSBQJSJRLNQH-RSAXXLAASA-N.
| Molecular formula | C19H25ClN2O2 |
|---|---|
| Molecular weight | 348.9 g/mol |
| IUPAC name | (2S)-2-amino-N-[[4-(3,5-dimethylphenoxy)-3-methylphenyl]methyl]propanamide;hydrochloride |
| InChIKey | OQGSBQJSJRLNQH-RSAXXLAASA-N |
| SMILES | CC1=CC(=CC(=C1)OC2=C(C=C(C=C2)CNC(=O)[C@H](C)N)C)C.Cl |
Computed by PubChem (NCBI)