Products 2706404-03-5
CAS 2706404-03-5 is the registry number for Furanyl UF–17 (hydrochloride) (CRM). Offered by: GLPBio. Available pack sizes: 1mg.
N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-phenylfuran-2-carboxamide;hydrochloride (CAS 2706404-03-5) is a chemical compound with the molecular formula C19H25ClN2O2 and a molecular weight of 348.9 g/mol. IUPAC name: N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-phenylfuran-2-carboxamide;hydrochloride. InChIKey: BJAZDPZJGPQWQM-GBNZRNLASA-N.
| Molecular formula | C19H25ClN2O2 |
|---|---|
| Molecular weight | 348.9 g/mol |
| IUPAC name | N-[(1R,2R)-2-(dimethylamino)cyclohexyl]-N-phenylfuran-2-carboxamide;hydrochloride |
| InChIKey | BJAZDPZJGPQWQM-GBNZRNLASA-N |
| SMILES | CN(C)[C@@H]1CCCC[C@H]1N(C2=CC=CC=C2)C(=O)C3=CC=CO3.Cl |
Computed by PubChem (NCBI)
Synonyms:
Furanyl UF-17 (hydrochloride)