Products 182230-43-9
CAS 182230-43-9 appears in our catalog under these names: Voriconazole Impurity 19, Voriconazole Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol (CAS 182230-43-9) is a chemical compound with the molecular formula C16H14F3N5O and a molecular weight of 349.31 g/mol. IUPAC name: 2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol. InChIKey: BCEHBSKCWLPMDN-UHFFFAOYSA-N.
| Molecular formula | C16H14F3N5O |
|---|---|
| Molecular weight | 349.31 g/mol |
| IUPAC name | 2-(2,4-difluorophenyl)-3-(5-fluoropyrimidin-4-yl)-1-(1,2,4-triazol-1-yl)butan-2-ol |
| InChIKey | BCEHBSKCWLPMDN-UHFFFAOYSA-N |
| SMILES | CC(C1=NC=NC=C1F)C(CN2C=NC=N2)(C3=C(C=C(C=C3)F)F)O |
Computed by PubChem (NCBI)